C29H33N5O5 — CID 175358335
methyl (E)-5-[benzyl-[4-(4-methoxyanilino)-2-morpholin-4-ylpyrimidine-5-carbonyl]amino]pent-3-enoate (PubChem CID 175358335) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is methyl (E)-5-[benzyl-[4-(4-methoxyanilino)-2-morpholin-4-ylpyrimidine-5-carbonyl]amino]pent-3-enoate.
| Compound Name | methyl (E)-5-[benzyl-[4-(4-methoxyanilino)-2-morpholin-4-ylpyrimidine-5-carbonyl]amino]pent-3-enoate |
|---|---|
| PubChem CID | 175358335 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | methyl (E)-5-[benzyl-[4-(4-methoxyanilino)-2-morpholin-4-ylpyrimidine-5-carbonyl]amino]pent-3-enoate |
| SMILES | COC(=O)C/C=C/CN(Cc1ccccc1)C(=O)c1cnc(N2CCOCC2)nc1Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H33N5O5/c1-37-24-13-11-23(12-14-24)31-27-25(20-30-29(32-27)33-16-18-39-19-17-33)28(36)34(15-7-6-10-26(35)38-2)21-22-8-4-3-5-9-22/h3-9,11-14,20H,10,15-19,21H2,1-2H3,(H,30,31,32)/b7-6+ |
| InChIKey | MQLRPRUBXXNDOA-VOTSOKGWSA-N |
| XLogP | 3.83 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|