C19H13ClF3NO3 — CID 175360108
(Z)-3-(1-benzyl-5-chloro-2-oxo-3H-indol-3-yl)-2-(trifluoromethyl)prop-2-enoic acid (PubChem CID 175360108) has the molecular formula C19H13ClF3NO3 and a molecular weight of 395.76 g/mol. Its IUPAC name is (Z)-3-(1-benzyl-5-chloro-2-oxo-3H-indol-3-yl)-2-(trifluoromethyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(1-benzyl-5-chloro-2-oxo-3H-indol-3-yl)-2-(trifluoromethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 175360108 |
| Molecular Formula | C19H13ClF3NO3 |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (Z)-3-(1-benzyl-5-chloro-2-oxo-3H-indol-3-yl)-2-(trifluoromethyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/C1C(=O)N(Cc2ccccc2)c2ccc(Cl)cc21)C(F)(F)F |
| InChI | InChI=1S/C19H13ClF3NO3/c20-12-6-7-16-13(8-12)14(9-15(18(26)27)19(21,22)23)17(25)24(16)10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H,26,27)/b15-9- |
| InChIKey | QDFVWAKRCWTVJG-DHDCSXOGSA-N |
| XLogP | 4.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|