About 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid
1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid (PubChem CID 175361043) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid.
Analyze 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
The IUPAC name of 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid (CID 175361043) is 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid.
What is the SMILES notation for 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
The canonical SMILES for 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid is CC1c2c(cnn2C)CN1C(=O)O.
What is the InChIKey of 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
The InChIKey is QMWNTLXEZZCRED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-5-7-6(3-9-10(7)2)4-11(5)8(12)13/h3,5H,4H2,1-2H3,(H,12,13).
What are the key properties of 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid?
1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid has a molecular weight of 181.19 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylic acid is sourced from PubChem (CID 175361043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).