About boric acid;lead(2+);sulfate
boric acid;lead(2+);sulfate (PubChem CID 175363823) has the molecular formula H3BO7PbS
and a molecular weight of 365.10 g/mol. Its IUPAC name is boric acid;lead(2+);sulfate.
Molecular Properties
| Compound Name | boric acid;lead(2+);sulfate |
| PubChem CID | 175363823 |
| Molecular Formula | H3BO7PbS |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | boric acid;lead(2+);sulfate |
| SMILES | O=S(=O)([O-])[O-].OB(O)O.[Pb+2] |
| InChI | InChI=1S/BH3O3.H2O4S.Pb/c2-1(3)4;1-5(2,3)4;/h2-4H;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | NLBSVNBGIFQBER-UHFFFAOYSA-L |
| XLogP | -3.77 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze boric acid;lead(2+);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;lead(2+);sulfate?
The IUPAC name of boric acid;lead(2+);sulfate (CID 175363823) is boric acid;lead(2+);sulfate.
What is the SMILES notation for boric acid;lead(2+);sulfate?
The canonical SMILES for boric acid;lead(2+);sulfate is O=S(=O)([O-])[O-].OB(O)O.[Pb+2].
What is the InChIKey of boric acid;lead(2+);sulfate?
The InChIKey is NLBSVNBGIFQBER-UHFFFAOYSA-L. The full InChI is InChI=1S/BH3O3.H2O4S.Pb/c2-1(3)4;1-5(2,3)4;/h2-4H;(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of boric acid;lead(2+);sulfate?
boric acid;lead(2+);sulfate has a molecular weight of 365.10 g/mol, XLogP of -3.77, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;lead(2+);sulfate is sourced from PubChem (CID 175363823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).