C21H26BrN3O6 — CID 175364388
[2-[2-[3-(5-bromo-2-nitroanilino)phenoxy]ethoxy]-3,3-dimethylbutyl] carbamate (PubChem CID 175364388) has the molecular formula C21H26BrN3O6 and a molecular weight of 496.36 g/mol. Its IUPAC name is [2-[2-[3-(5-bromo-2-nitroanilino)phenoxy]ethoxy]-3,3-dimethylbutyl] carbamate.
| Compound Name | [2-[2-[3-(5-bromo-2-nitroanilino)phenoxy]ethoxy]-3,3-dimethylbutyl] carbamate |
|---|---|
| PubChem CID | 175364388 |
| Molecular Formula | C21H26BrN3O6 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | [2-[2-[3-(5-bromo-2-nitroanilino)phenoxy]ethoxy]-3,3-dimethylbutyl] carbamate |
| SMILES | CC(C)(C)C(COC(N)=O)OCCOc1cccc(Nc2cc(Br)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26BrN3O6/c1-21(2,3)19(13-31-20(23)26)30-10-9-29-16-6-4-5-15(12-16)24-17-11-14(22)7-8-18(17)25(27)28/h4-8,11-12,19,24H,9-10,13H2,1-3H3,(H2,23,26) |
| InChIKey | ZZSDJRBJMCPMBC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|