C31H24N6O — CID 175366202
8-(6-methoxyquinolin-2-yl)-6,10-dimethyl-4,12-diphenyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene (PubChem CID 175366202) has the molecular formula C31H24N6O and a molecular weight of 496.57 g/mol. Its IUPAC name is 8-(6-methoxyquinolin-2-yl)-6,10-dimethyl-4,12-diphenyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene.
| Compound Name | 8-(6-methoxyquinolin-2-yl)-6,10-dimethyl-4,12-diphenyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
|---|---|
| PubChem CID | 175366202 |
| Molecular Formula | C31H24N6O |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 8-(6-methoxyquinolin-2-yl)-6,10-dimethyl-4,12-diphenyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
| SMILES | COc1ccc2nc(-c3c4c(C)nn(-c5ccccc5)c4nc4c3c(C)nn4-c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C31H24N6O/c1-19-27-29(26-16-14-21-18-24(38-3)15-17-25(21)32-26)28-20(2)35-37(23-12-8-5-9-13-23)31(28)33-30(27)36(34-19)22-10-6-4-7-11-22/h4-18H,1-3H3 |
| InChIKey | JTCWLWPVTWYEKC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |