C20H24N6OS — CID 175367380
5-[4-(N-[(1-methylpiperidin-4-yl)amino]anilino)-1H-pyrazol-5-yl]thiophene-2-carboxamide (PubChem CID 175367380) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 5-[4-(N-[(1-methylpiperidin-4-yl)amino]anilino)-1H-pyrazol-5-yl]thiophene-2-carboxamide.
| Compound Name | 5-[4-(N-[(1-methylpiperidin-4-yl)amino]anilino)-1H-pyrazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 175367380 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-[4-(N-[(1-methylpiperidin-4-yl)amino]anilino)-1H-pyrazol-5-yl]thiophene-2-carboxamide |
| SMILES | CN1CCC(NN(c2ccccc2)c2cn[nH]c2-c2ccc(C(N)=O)s2)CC1 |
| InChI | InChI=1S/C20H24N6OS/c1-25-11-9-14(10-12-25)24-26(15-5-3-2-4-6-15)16-13-22-23-19(16)17-7-8-18(28-17)20(21)27/h2-8,13-14,24H,9-12H2,1H3,(H2,21,27)(H,22,23) |
| InChIKey | MSMDQKVXKNAQAZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|