C16H14ClN5OS — CID 175368494
7-(2-chlorophenyl)-12-methylsulfanyl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraene-8-carbaldehyde (PubChem CID 175368494) has the molecular formula C16H14ClN5OS and a molecular weight of 359.84 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-12-methylsulfanyl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraene-8-carbaldehyde.
| Compound Name | 7-(2-chlorophenyl)-12-methylsulfanyl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraene-8-carbaldehyde |
|---|---|
| PubChem CID | 175368494 |
| Molecular Formula | C16H14ClN5OS |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 7-(2-chlorophenyl)-12-methylsulfanyl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraene-8-carbaldehyde |
| SMILES | CSc1ncc2c(n1)N1CCN=C1N(c1ccccc1Cl)C2C=O |
| InChI | InChI=1S/C16H14ClN5OS/c1-24-15-19-8-10-13(9-23)22(12-5-3-2-4-11(12)17)16-18-6-7-21(16)14(10)20-15/h2-5,8-9,13H,6-7H2,1H3 |
| InChIKey | IXXGLVCVURPMKO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|