About hydroxy phosphate;iron(2+);manganese
hydroxy phosphate;iron(2+);manganese (PubChem CID 175368870) has the molecular formula HFeMnO5P
and a molecular weight of 222.76 g/mol. Its IUPAC name is hydroxy phosphate;iron(2+);manganese.
Molecular Properties
| Compound Name | hydroxy phosphate;iron(2+);manganese |
| PubChem CID | 175368870 |
| Molecular Formula | HFeMnO5P |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.83 |
| IUPAC Name | hydroxy phosphate;iron(2+);manganese |
| SMILES | O=P([O-])([O-])OO.[Fe+2].[Mn] |
| InChI | InChI=1S/Fe.Mn.H3O5P/c;;1-5-6(2,3)4/h;;1H,(H2,2,3,4)/q+2;;/p-2 |
| InChIKey | SEOQXTUCVVEEII-UHFFFAOYSA-L |
| XLogP | -1.70 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy phosphate;iron(2+);manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy phosphate;iron(2+);manganese?
The IUPAC name of hydroxy phosphate;iron(2+);manganese (CID 175368870) is hydroxy phosphate;iron(2+);manganese.
What is the SMILES notation for hydroxy phosphate;iron(2+);manganese?
The canonical SMILES for hydroxy phosphate;iron(2+);manganese is O=P([O-])([O-])OO.[Fe+2].[Mn].
What is the InChIKey of hydroxy phosphate;iron(2+);manganese?
The InChIKey is SEOQXTUCVVEEII-UHFFFAOYSA-L. The full InChI is InChI=1S/Fe.Mn.H3O5P/c;;1-5-6(2,3)4/h;;1H,(H2,2,3,4)/q+2;;/p-2.
What are the key properties of hydroxy phosphate;iron(2+);manganese?
hydroxy phosphate;iron(2+);manganese has a molecular weight of 222.76 g/mol, XLogP of -1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy phosphate;iron(2+);manganese is sourced from PubChem (CID 175368870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).