About calcium;hydroxy phosphate;silane
calcium;hydroxy phosphate;silane (PubChem CID 174493436) has the molecular formula H5CaO5PSi
and a molecular weight of 184.17 g/mol. Its IUPAC name is calcium;hydroxy phosphate;silane.
Molecular Properties
| Compound Name | calcium;hydroxy phosphate;silane |
| PubChem CID | 174493436 |
| Molecular Formula | H5CaO5PSi |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 183.93 |
| IUPAC Name | calcium;hydroxy phosphate;silane |
| SMILES | O=P([O-])([O-])OO.[Ca+2].[SiH4] |
| InChI | InChI=1S/Ca.H3O5P.H4Si/c;1-5-6(2,3)4;/h;1H,(H2,2,3,4);1H4/q+2;;/p-2 |
| InChIKey | MEABBDXEOLAIPO-UHFFFAOYSA-L |
| XLogP | -3.53 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydroxy phosphate;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydroxy phosphate;silane?
The IUPAC name of calcium;hydroxy phosphate;silane (CID 174493436) is calcium;hydroxy phosphate;silane.
What is the SMILES notation for calcium;hydroxy phosphate;silane?
The canonical SMILES for calcium;hydroxy phosphate;silane is O=P([O-])([O-])OO.[Ca+2].[SiH4].
What is the InChIKey of calcium;hydroxy phosphate;silane?
The InChIKey is MEABBDXEOLAIPO-UHFFFAOYSA-L. The full InChI is InChI=1S/Ca.H3O5P.H4Si/c;1-5-6(2,3)4;/h;1H,(H2,2,3,4);1H4/q+2;;/p-2.
What are the key properties of calcium;hydroxy phosphate;silane?
calcium;hydroxy phosphate;silane has a molecular weight of 184.17 g/mol, XLogP of -3.53, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydroxy phosphate;silane is sourced from PubChem (CID 174493436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).