About dicalcium;phosphonatooxy phosphate
dicalcium;phosphonatooxy phosphate (PubChem CID 25022457) has the molecular formula Ca2O8P2
and a molecular weight of 270.10 g/mol. Its IUPAC name is dicalcium;phosphonatooxy phosphate.
Molecular Properties
| Compound Name | dicalcium;phosphonatooxy phosphate |
| PubChem CID | 25022457 |
| Molecular Formula | Ca2O8P2 |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 269.83 |
| IUPAC Name | dicalcium;phosphonatooxy phosphate |
| SMILES | O=P([O-])([O-])OOP(=O)([O-])[O-].[Ca+2].[Ca+2] |
| InChI | InChI=1S/2Ca.H4O8P2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4 |
| InChIKey | HKFSYZNEVYQKCU-UHFFFAOYSA-J |
| XLogP | -4.17 |
| TPSA | 144.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;phosphonatooxy phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;phosphonatooxy phosphate?
The IUPAC name of dicalcium;phosphonatooxy phosphate (CID 25022457) is dicalcium;phosphonatooxy phosphate.
What is the SMILES notation for dicalcium;phosphonatooxy phosphate?
The canonical SMILES for dicalcium;phosphonatooxy phosphate is O=P([O-])([O-])OOP(=O)([O-])[O-].[Ca+2].[Ca+2].
What is the InChIKey of dicalcium;phosphonatooxy phosphate?
The InChIKey is HKFSYZNEVYQKCU-UHFFFAOYSA-J. The full InChI is InChI=1S/2Ca.H4O8P2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4.
What are the key properties of dicalcium;phosphonatooxy phosphate?
dicalcium;phosphonatooxy phosphate has a molecular weight of 270.10 g/mol, XLogP of -4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;phosphonatooxy phosphate is sourced from PubChem (CID 25022457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).