C14H29N5O2 — CID 175369374
N'-(2-aminoethyl)ethane-1,2-diamine;1,6-bis(aziridin-1-yl)hexane-1,6-dione (PubChem CID 175369374) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;1,6-bis(aziridin-1-yl)hexane-1,6-dione.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;1,6-bis(aziridin-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 175369374 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;1,6-bis(aziridin-1-yl)hexane-1,6-dione |
| SMILES | NCCNCCN.O=C(CCCCC(=O)N1CC1)N1CC1 |
| InChI | InChI=1S/C10H16N2O2.C4H13N3/c13-9(11-5-6-11)3-1-2-4-10(14)12-7-8-12;5-1-3-7-4-2-6/h1-8H2;7H,1-6H2 |
| InChIKey | BMDAYHNRVUJNRQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|