C18H35ClN4O3 — CID 119316226
3-amino-N-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]propanamide;hydrochloride (PubChem CID 119316226) has the molecular formula C18H35ClN4O3 and a molecular weight of 390.96 g/mol. Its IUPAC name is 3-amino-N-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119316226 |
| Molecular Formula | C18H35ClN4O3 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-amino-N-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]propanamide;hydrochloride |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)CCCCCNC(=O)CCN)CC1.Cl |
| InChI | InChI=1S/C18H34N4O3.ClH/c1-15(2)14-18(25)22-12-10-21(11-13-22)17(24)6-4-3-5-9-20-16(23)7-8-19;/h15H,3-14,19H2,1-2H3,(H,20,23);1H |
| InChIKey | YGYRVHSZASKVNE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|