C25H41N5O2 — CID 111098613
2-benzyl-1,1-dimethyl-3-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine (PubChem CID 111098613) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine |
|---|---|
| PubChem CID | 111098613 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)CCCCCN/C(=N/Cc2ccccc2)N(C)C)CC1 |
| InChI | InChI=1S/C25H41N5O2/c1-21(2)19-24(32)30-17-15-29(16-18-30)23(31)13-9-6-10-14-26-25(28(3)4)27-20-22-11-7-5-8-12-22/h5,7-8,11-12,21H,6,9-10,13-20H2,1-4H3,(H,26,27) |
| InChIKey | FOTAJOZOUMFETM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|