C4H11N2NaO3S2 — CID 175370370
sodium;1-(carbamothioylamino)propane-1-sulfonic acid;hydride (PubChem CID 175370370) has the molecular formula C4H11N2NaO3S2 and a molecular weight of 222.27 g/mol. Its IUPAC name is sodium;1-(carbamothioylamino)propane-1-sulfonic acid;hydride.
| Compound Name | sodium;1-(carbamothioylamino)propane-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 175370370 |
| Molecular Formula | C4H11N2NaO3S2 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | sodium;1-(carbamothioylamino)propane-1-sulfonic acid;hydride |
| SMILES | CCC(NC(N)=S)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H10N2O3S2.Na.H/c1-2-3(6-4(5)10)11(7,8)9;;/h3H,2H2,1H3,(H3,5,6,10)(H,7,8,9);;/q;+1;-1 |
| InChIKey | XPYFQFGYEQXQPX-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|