C12H17N2NaO7S — CID 87880986
sodium;1-[(5-amino-2-methylidene-5-oxopent-3-enoyl)amino]propane-1-sulfonic acid;prop-2-enoate (PubChem CID 87880986) has the molecular formula C12H17N2NaO7S and a molecular weight of 356.33 g/mol. Its IUPAC name is sodium;1-[(5-amino-2-methylidene-5-oxopent-3-enoyl)amino]propane-1-sulfonic acid;prop-2-enoate.
| Compound Name | sodium;1-[(5-amino-2-methylidene-5-oxopent-3-enoyl)amino]propane-1-sulfonic acid;prop-2-enoate |
|---|---|
| PubChem CID | 87880986 |
| Molecular Formula | C12H17N2NaO7S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | sodium;1-[(5-amino-2-methylidene-5-oxopent-3-enoyl)amino]propane-1-sulfonic acid;prop-2-enoate |
| SMILES | C=C(C=CC(N)=O)C(=O)NC(CC)S(=O)(=O)O.C=CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H14N2O5S.C3H4O2.Na/c1-3-8(17(14,15)16)11-9(13)6(2)4-5-7(10)12;1-2-3(4)5;/h4-5,8H,2-3H2,1H3,(H2,10,12)(H,11,13)(H,14,15,16);2H,1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | ILFODMIBNXLEHE-UHFFFAOYSA-M |
| XLogP | -4.75 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|