C23H21BrN5O3S2- — CID 175370578
1-[3-[(5-bromothiophen-2-yl)-sulfinatoamino]cyclohexyl]-5-carbamoyl-2-pyridin-2-ylbenzimidazole (PubChem CID 175370578) has the molecular formula C23H21BrN5O3S2- and a molecular weight of 559.49 g/mol. Its IUPAC name is 1-[3-[(5-bromothiophen-2-yl)-sulfinatoamino]cyclohexyl]-5-carbamoyl-2-pyridin-2-ylbenzimidazole.
| Compound Name | 1-[3-[(5-bromothiophen-2-yl)-sulfinatoamino]cyclohexyl]-5-carbamoyl-2-pyridin-2-ylbenzimidazole |
|---|---|
| PubChem CID | 175370578 |
| Molecular Formula | C23H21BrN5O3S2- |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | 1-[3-[(5-bromothiophen-2-yl)-sulfinatoamino]cyclohexyl]-5-carbamoyl-2-pyridin-2-ylbenzimidazole |
| SMILES | NC(=O)c1ccc2c(c1)nc(-c1ccccn1)n2C1CCCC(N(c2ccc(Br)s2)S(=O)[O-])C1 |
| InChI | InChI=1S/C23H22BrN5O3S2/c24-20-9-10-21(33-20)29(34(31)32)16-5-3-4-15(13-16)28-19-8-7-14(22(25)30)12-18(19)27-23(28)17-6-1-2-11-26-17/h1-2,6-12,15-16H,3-5,13H2,(H2,25,30)(H,31,32)/p-1 |
| InChIKey | XMOHGELCIQPLAR-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|