C7H9IN2O2 — CID 175372742
1-(1,4-dioxan-2-yl)-4-iodopyrazole (PubChem CID 175372742) has the molecular formula C7H9IN2O2 and a molecular weight of 280.06 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-4-iodopyrazole.
| Compound Name | 1-(1,4-dioxan-2-yl)-4-iodopyrazole |
|---|---|
| PubChem CID | 175372742 |
| Molecular Formula | C7H9IN2O2 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-4-iodopyrazole |
| SMILES | Ic1cnn(C2COCCO2)c1 |
| InChI | InChI=1S/C7H9IN2O2/c8-6-3-9-10(4-6)7-5-11-1-2-12-7/h3-4,7H,1-2,5H2 |
| InChIKey | JTHOECNXPTVSDM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|