About 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride
2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride (PubChem CID 175372771) has the molecular formula C15H35ClN2O
and a molecular weight of 294.91 g/mol. Its IUPAC name is 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride |
| PubChem CID | 175372771 |
| Molecular Formula | C15H35ClN2O |
| Molecular Weight | 294.91 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride |
| SMILES | C=C(C)C.CCCCCNOCCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C11H27N2O.C4H8.ClH/c1-5-6-7-9-12-14-11-8-10-13(2,3)4;1-4(2)3;/h12H,5-11H2,1-4H3;1H2,2-3H3;1H/q+1;;/p-1 |
| InChIKey | NKKLFZDIGDUTMG-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.91 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride?
The IUPAC name of 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride (CID 175372771) is 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride.
What is the SMILES notation for 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride?
The canonical SMILES for 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride is C=C(C)C.CCCCCNOCCC[N+](C)(C)C.[Cl-].
What is the InChIKey of 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride?
The InChIKey is NKKLFZDIGDUTMG-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H27N2O.C4H8.ClH/c1-5-6-7-9-12-14-11-8-10-13(2,3)4;1-4(2)3;/h12H,5-11H2,1-4H3;1H2,2-3H3;1H/q+1;;/p-1.
What are the key properties of 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride?
2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride has a molecular weight of 294.91 g/mol, XLogP of 0.38, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;trimethyl-[3-(pentylamino)oxypropyl]azanium;chloride is sourced from PubChem (CID 175372771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).