C21H31N3O5 — CID 175372932
2-[[4-methyl-2-(phenylmethoxycarbonylamino)pentyl]amino]-3-oxo-2-pyrrolidin-1-ylpropanoic acid (PubChem CID 175372932) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[[4-methyl-2-(phenylmethoxycarbonylamino)pentyl]amino]-3-oxo-2-pyrrolidin-1-ylpropanoic acid.
| Compound Name | 2-[[4-methyl-2-(phenylmethoxycarbonylamino)pentyl]amino]-3-oxo-2-pyrrolidin-1-ylpropanoic acid |
|---|---|
| PubChem CID | 175372932 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[[4-methyl-2-(phenylmethoxycarbonylamino)pentyl]amino]-3-oxo-2-pyrrolidin-1-ylpropanoic acid |
| SMILES | CC(C)CC(CNC(C=O)(C(=O)O)N1CCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31N3O5/c1-16(2)12-18(23-20(28)29-14-17-8-4-3-5-9-17)13-22-21(15-25,19(26)27)24-10-6-7-11-24/h3-5,8-9,15-16,18,22H,6-7,10-14H2,1-2H3,(H,23,28)(H,26,27) |
| InChIKey | ZEFUBGYFMFNJTC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|