C22H32N4O4 — CID 90772429
benzyl N-[(2S)-1-[(3-amino-3-oxo-1-piperidin-1-ylprop-1-en-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 90772429) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(3-amino-3-oxo-1-piperidin-1-ylprop-1-en-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(3-amino-3-oxo-1-piperidin-1-ylprop-1-en-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 90772429 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | benzyl N-[(2S)-1-[(3-amino-3-oxo-1-piperidin-1-ylprop-1-en-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NC(=CN1CCCCC1)C(N)=O |
| InChI | InChI=1S/C22H32N4O4/c1-16(2)13-18(25-22(29)30-15-17-9-5-3-6-10-17)21(28)24-19(20(23)27)14-26-11-7-4-8-12-26/h3,5-6,9-10,14,16,18H,4,7-8,11-13,15H2,1-2H3,(H2,23,27)(H,24,28)(H,25,29)/t18-/m0/s1 |
| InChIKey | GWHBBZMXXVLXEZ-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|