C19H26N4O5 — CID 59101235
benzyl N-[(2S)-1-[[(Z)-1-acetamido-3-amino-3-oxoprop-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 59101235) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(Z)-1-acetamido-3-amino-3-oxoprop-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(Z)-1-acetamido-3-amino-3-oxoprop-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 59101235 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | benzyl N-[(2S)-1-[[(Z)-1-acetamido-3-amino-3-oxoprop-1-en-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(=O)N/C=C(\NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C19H26N4O5/c1-12(2)9-15(18(26)22-16(17(20)25)10-21-13(3)24)23-19(27)28-11-14-7-5-4-6-8-14/h4-8,10,12,15H,9,11H2,1-3H3,(H2,20,25)(H,21,24)(H,22,26)(H,23,27)/b16-10-/t15-/m0/s1 |
| InChIKey | RBHFKIPAXUVOCN-HEUOVEHFSA-N |
| XLogP | 0.91 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|