C26H36N2O7S — CID 175375280
[5-ethyl-3-(3-hydroxypentyl)-2-pyridinyl]sulfamoyl 3-methyl-2-(oxan-4-ylmethoxy)benzoate (PubChem CID 175375280) has the molecular formula C26H36N2O7S and a molecular weight of 520.65 g/mol. Its IUPAC name is [5-ethyl-3-(3-hydroxypentyl)-2-pyridinyl]sulfamoyl 3-methyl-2-(oxan-4-ylmethoxy)benzoate.
| Compound Name | [5-ethyl-3-(3-hydroxypentyl)-2-pyridinyl]sulfamoyl 3-methyl-2-(oxan-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 175375280 |
| Molecular Formula | C26H36N2O7S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [5-ethyl-3-(3-hydroxypentyl)-2-pyridinyl]sulfamoyl 3-methyl-2-(oxan-4-ylmethoxy)benzoate |
| SMILES | CCc1cnc(NS(=O)(=O)OC(=O)c2cccc(C)c2OCC2CCOCC2)c(CCC(O)CC)c1 |
| InChI | InChI=1S/C26H36N2O7S/c1-4-19-15-21(9-10-22(29)5-2)25(27-16-19)28-36(31,32)35-26(30)23-8-6-7-18(3)24(23)34-17-20-11-13-33-14-12-20/h6-8,15-16,20,22,29H,4-5,9-14,17H2,1-3H3,(H,27,28) |
| InChIKey | RGYOTGXHEOXJKB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |