C26H37N3O6 — CID 175380130
(2S)-2-[[(2-benzylcyclopentyl)oxycarbonylamino]-(4-methylpentanoyl)amino]-3-(2-oxopyrrolidin-3-yl)propanoic acid (PubChem CID 175380130) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2S)-2-[[(2-benzylcyclopentyl)oxycarbonylamino]-(4-methylpentanoyl)amino]-3-(2-oxopyrrolidin-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2-benzylcyclopentyl)oxycarbonylamino]-(4-methylpentanoyl)amino]-3-(2-oxopyrrolidin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 175380130 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (2S)-2-[[(2-benzylcyclopentyl)oxycarbonylamino]-(4-methylpentanoyl)amino]-3-(2-oxopyrrolidin-3-yl)propanoic acid |
| SMILES | CC(C)CCC(=O)N(NC(=O)OC1CCCC1Cc1ccccc1)[C@@H](CC1CCNC1=O)C(=O)O |
| InChI | InChI=1S/C26H37N3O6/c1-17(2)11-12-23(30)29(21(25(32)33)16-20-13-14-27-24(20)31)28-26(34)35-22-10-6-9-19(22)15-18-7-4-3-5-8-18/h3-5,7-8,17,19-22H,6,9-16H2,1-2H3,(H,27,31)(H,28,34)(H,32,33)/t19?,20?,21-,22?/m0/s1 |
| InChIKey | VBCMXWUHXREKPU-GMONCZTGSA-N |
| XLogP | 3.28 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|