About 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile
4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile (PubChem CID 175381487) has the molecular formula C10H7BrF3NO
and a molecular weight of 294.07 g/mol. Its IUPAC name is 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile |
| PubChem CID | 175381487 |
| Molecular Formula | C10H7BrF3NO |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1O[C@@H](CF)C(F)F |
| InChI | InChI=1S/C10H7BrF3NO/c11-7-2-1-6(5-15)8(3-7)16-9(4-12)10(13)14/h1-3,9-10H,4H2/t9-/m0/s1 |
| InChIKey | JUDQVZWXSMYBPK-VIFPVBQESA-N |
| XLogP | 3.30 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile?
The IUPAC name of 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile (CID 175381487) is 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile.
What is the SMILES notation for 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile?
The canonical SMILES for 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile is N#Cc1ccc(Br)cc1O[C@@H](CF)C(F)F.
What is the InChIKey of 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile?
The InChIKey is JUDQVZWXSMYBPK-VIFPVBQESA-N. The full InChI is InChI=1S/C10H7BrF3NO/c11-7-2-1-6(5-15)8(3-7)16-9(4-12)10(13)14/h1-3,9-10H,4H2/t9-/m0/s1.
What are the key properties of 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile?
4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile has a molecular weight of 294.07 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[(2S)-1,1,3-trifluoropropan-2-yl]oxybenzonitrile is sourced from PubChem (CID 175381487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).