C20H13ClF5N3O3 — CID 175383176
6-(4-chlorophenyl)-2-(3,5-difluorophenyl)-3-oxo-N-[(2S)-1,3,3-trifluoro-2-hydroxypropyl]pyridazine-4-carboxamide (PubChem CID 175383176) has the molecular formula C20H13ClF5N3O3 and a molecular weight of 473.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(3,5-difluorophenyl)-3-oxo-N-[(2S)-1,3,3-trifluoro-2-hydroxypropyl]pyridazine-4-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-2-(3,5-difluorophenyl)-3-oxo-N-[(2S)-1,3,3-trifluoro-2-hydroxypropyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 175383176 |
| Molecular Formula | C20H13ClF5N3O3 |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(3,5-difluorophenyl)-3-oxo-N-[(2S)-1,3,3-trifluoro-2-hydroxypropyl]pyridazine-4-carboxamide |
| SMILES | O=C(NC(F)[C@H](O)C(F)F)c1cc(-c2ccc(Cl)cc2)nn(-c2cc(F)cc(F)c2)c1=O |
| InChI | InChI=1S/C20H13ClF5N3O3/c21-10-3-1-9(2-4-10)15-8-14(19(31)27-18(26)16(30)17(24)25)20(32)29(28-15)13-6-11(22)5-12(23)7-13/h1-8,16-18,30H,(H,27,31)/t16-,18?/m1/s1 |
| InChIKey | FNTMBBXETMXKGI-PYUWXLGESA-N |
| XLogP | 3.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|