About 1-(cyclohexylamino)ethanesulfonic acid;ethanol
1-(cyclohexylamino)ethanesulfonic acid;ethanol (PubChem CID 175383894) has the molecular formula C10H23NO4S
and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-(cyclohexylamino)ethanesulfonic acid;ethanol.
Molecular Properties
| Compound Name | 1-(cyclohexylamino)ethanesulfonic acid;ethanol |
| PubChem CID | 175383894 |
| Molecular Formula | C10H23NO4S |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(cyclohexylamino)ethanesulfonic acid;ethanol |
| SMILES | CC(NC1CCCCC1)S(=O)(=O)O.CCO |
| InChI | InChI=1S/C8H17NO3S.C2H6O/c1-7(13(10,11)12)9-8-5-3-2-4-6-8;1-2-3/h7-9H,2-6H2,1H3,(H,10,11,12);3H,2H2,1H3 |
| InChIKey | UDAHNGJSAGWBOE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexylamino)ethanesulfonic acid;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylamino)ethanesulfonic acid;ethanol?
The IUPAC name of 1-(cyclohexylamino)ethanesulfonic acid;ethanol (CID 175383894) is 1-(cyclohexylamino)ethanesulfonic acid;ethanol.
What is the SMILES notation for 1-(cyclohexylamino)ethanesulfonic acid;ethanol?
The canonical SMILES for 1-(cyclohexylamino)ethanesulfonic acid;ethanol is CC(NC1CCCCC1)S(=O)(=O)O.CCO.
What is the InChIKey of 1-(cyclohexylamino)ethanesulfonic acid;ethanol?
The InChIKey is UDAHNGJSAGWBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3S.C2H6O/c1-7(13(10,11)12)9-8-5-3-2-4-6-8;1-2-3/h7-9H,2-6H2,1H3,(H,10,11,12);3H,2H2,1H3.
What are the key properties of 1-(cyclohexylamino)ethanesulfonic acid;ethanol?
1-(cyclohexylamino)ethanesulfonic acid;ethanol has a molecular weight of 253.36 g/mol, XLogP of 1.14, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylamino)ethanesulfonic acid;ethanol is sourced from PubChem (CID 175383894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).