C8H9Cl2NO — CID 175384406
2,3-dichloro-4-(1-methoxyethyl)pyridine (PubChem CID 175384406) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is 2,3-dichloro-4-(1-methoxyethyl)pyridine.
| Compound Name | 2,3-dichloro-4-(1-methoxyethyl)pyridine |
|---|---|
| PubChem CID | 175384406 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 2,3-dichloro-4-(1-methoxyethyl)pyridine |
| SMILES | COC(C)c1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C8H9Cl2NO/c1-5(12-2)6-3-4-11-8(10)7(6)9/h3-5H,1-2H3 |
| InChIKey | BBZLZSASOPDKHE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|