C7H8Cl2N2O2 — CID 139536241
2,4-dichloro-5-(dimethoxymethyl)pyrimidine (PubChem CID 139536241) has the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.06 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethoxymethyl)pyrimidine.
| Compound Name | 2,4-dichloro-5-(dimethoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 139536241 |
| Molecular Formula | C7H8Cl2N2O2 |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2,4-dichloro-5-(dimethoxymethyl)pyrimidine |
| SMILES | COC(OC)c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C7H8Cl2N2O2/c1-12-6(13-2)4-3-10-7(9)11-5(4)8/h3,6H,1-2H3 |
| InChIKey | KGZHQLLGDLTKNP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|