C8H11Cl2N3 — CID 53385528
N-[(2,4-dichloropyrimidin-5-yl)methyl]propan-2-amine (PubChem CID 53385528) has the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. Its IUPAC name is N-[(2,4-dichloropyrimidin-5-yl)methyl]propan-2-amine.
| Compound Name | N-[(2,4-dichloropyrimidin-5-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 53385528 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | N-[(2,4-dichloropyrimidin-5-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C8H11Cl2N3/c1-5(2)11-3-6-4-12-8(10)13-7(6)9/h4-5,11H,3H2,1-2H3 |
| InChIKey | NVAHMXACMSTMRU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |