C6H5Cl2FN2 — CID 83854274
2,4-dichloro-5-(2-fluoroethyl)pyrimidine (PubChem CID 83854274) has the molecular formula C6H5Cl2FN2 and a molecular weight of 195.02 g/mol. Its IUPAC name is 2,4-dichloro-5-(2-fluoroethyl)pyrimidine.
| Compound Name | 2,4-dichloro-5-(2-fluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 83854274 |
| Molecular Formula | C6H5Cl2FN2 |
| Molecular Weight | 195.02 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 2,4-dichloro-5-(2-fluoroethyl)pyrimidine |
| SMILES | FCCc1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C6H5Cl2FN2/c7-5-4(1-2-9)3-10-6(8)11-5/h3H,1-2H2 |
| InChIKey | LPUFTNHIMYBCOR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.02 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |