C9H9Cl2N3O — CID 170969547
1-[(2,4-dichloropyrimidin-5-yl)methyl]pyrrolidin-2-one (PubChem CID 170969547) has the molecular formula C9H9Cl2N3O and a molecular weight of 246.10 g/mol. Its IUPAC name is 1-[(2,4-dichloropyrimidin-5-yl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[(2,4-dichloropyrimidin-5-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 170969547 |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 1-[(2,4-dichloropyrimidin-5-yl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O/c10-8-6(4-12-9(11)13-8)5-14-3-1-2-7(14)15/h4H,1-3,5H2 |
| InChIKey | DFBLXFUDXNHUSC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |