C11H15N3O — CID 62464540
1-[[2-(methylamino)-3-pyridinyl]methyl]pyrrolidin-2-one (PubChem CID 62464540) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[[2-(methylamino)-3-pyridinyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[2-(methylamino)-3-pyridinyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 62464540 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-[[2-(methylamino)-3-pyridinyl]methyl]pyrrolidin-2-one |
| SMILES | CNc1ncccc1CN1CCCC1=O |
| InChI | InChI=1S/C11H15N3O/c1-12-11-9(4-2-6-13-11)8-14-7-3-5-10(14)15/h2,4,6H,3,5,7-8H2,1H3,(H,12,13) |
| InChIKey | MOCQAHNMUBMMRQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |