C18H18F3N3O — CID 86979298
1-[[2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]methyl]pyrrolidin-2-one (PubChem CID 86979298) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is 1-[[2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 86979298 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[[2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1ccccc1CNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O/c19-18(20,21)15-7-3-9-22-17(15)23-11-13-5-1-2-6-14(13)12-24-10-4-8-16(24)25/h1-3,5-7,9H,4,8,10-12H2,(H,22,23) |
| InChIKey | OAMKMCUIADBWFY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |