About sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride
sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride (PubChem CID 175385269) has the molecular formula C7H14NNaO4S
and a molecular weight of 231.25 g/mol. Its IUPAC name is sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride.
Molecular Properties
| Compound Name | sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride |
| PubChem CID | 175385269 |
| Molecular Formula | C7H14NNaO4S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride |
| SMILES | C=CC(=O)OS(=O)(=O)CC(C)CN.[H-].[Na+] |
| InChI | InChI=1S/C7H13NO4S.Na.H/c1-3-7(9)12-13(10,11)5-6(2)4-8;;/h3,6H,1,4-5,8H2,2H3;;/q;+1;-1 |
| InChIKey | VXWIZLKKMRXIRT-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride?
The IUPAC name of sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride (CID 175385269) is sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride.
What is the SMILES notation for sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride?
The canonical SMILES for sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride is C=CC(=O)OS(=O)(=O)CC(C)CN.[H-].[Na+].
What is the InChIKey of sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride?
The InChIKey is VXWIZLKKMRXIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.Na.H/c1-3-7(9)12-13(10,11)5-6(2)4-8;;/h3,6H,1,4-5,8H2,2H3;;/q;+1;-1.
What are the key properties of sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride?
sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride has a molecular weight of 231.25 g/mol, XLogP of -3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(3-amino-2-methylpropyl)sulfonyl prop-2-enoate;hydride is sourced from PubChem (CID 175385269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).