C16H35O4P — CID 175385413
bis(2,3-dimethylhexan-2-yl) hydrogen phosphate (PubChem CID 175385413) has the molecular formula C16H35O4P and a molecular weight of 322.43 g/mol. Its IUPAC name is bis(2,3-dimethylhexan-2-yl) hydrogen phosphate.
| Compound Name | bis(2,3-dimethylhexan-2-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 175385413 |
| Molecular Formula | C16H35O4P |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | bis(2,3-dimethylhexan-2-yl) hydrogen phosphate |
| SMILES | CCCC(C)C(C)(C)OP(=O)(O)OC(C)(C)C(C)CCC |
| InChI | InChI=1S/C16H35O4P/c1-9-11-13(3)15(5,6)19-21(17,18)20-16(7,8)14(4)12-10-2/h13-14H,9-12H2,1-8H3,(H,17,18) |
| InChIKey | VLEYFQRWDFXHHW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|