C27H57O4P — CID 87189657
tris(2,3-dimethylheptan-2-yl) phosphate (PubChem CID 87189657) has the molecular formula C27H57O4P and a molecular weight of 476.72 g/mol. Its IUPAC name is tris(2,3-dimethylheptan-2-yl) phosphate.
| Compound Name | tris(2,3-dimethylheptan-2-yl) phosphate |
|---|---|
| PubChem CID | 87189657 |
| Molecular Formula | C27H57O4P |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.40 |
| IUPAC Name | tris(2,3-dimethylheptan-2-yl) phosphate |
| SMILES | CCCCC(C)C(C)(C)OP(=O)(OC(C)(C)C(C)CCCC)OC(C)(C)C(C)CCCC |
| InChI | InChI=1S/C27H57O4P/c1-13-16-19-22(4)25(7,8)29-32(28,30-26(9,10)23(5)20-17-14-2)31-27(11,12)24(6)21-18-15-3/h22-24H,13-21H2,1-12H3 |
| InChIKey | KNXDHIQKQDINBZ-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|