C27H25FO5 — CID 175386257
5-[5-[3-[2-(3-fluorophenyl)phenyl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]pentanoic acid (PubChem CID 175386257) has the molecular formula C27H25FO5 and a molecular weight of 448.49 g/mol. Its IUPAC name is 5-[5-[3-[2-(3-fluorophenyl)phenyl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]pentanoic acid.
| Compound Name | 5-[5-[3-[2-(3-fluorophenyl)phenyl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 175386257 |
| Molecular Formula | C27H25FO5 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 5-[5-[3-[2-(3-fluorophenyl)phenyl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]pentanoic acid |
| SMILES | COc1ccc(C=CC(=O)c2ccccc2-c2cccc(F)c2)cc1OCCCCC(=O)O |
| InChI | InChI=1S/C27H25FO5/c1-32-25-15-13-19(17-26(25)33-16-5-4-11-27(30)31)12-14-24(29)23-10-3-2-9-22(23)20-7-6-8-21(28)18-20/h2-3,6-10,12-15,17-18H,4-5,11,16H2,1H3,(H,30,31) |
| InChIKey | AWKJAWNOZJWFFI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|