C14H13F7N2O4 — CID 175387528
[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxyanilino]-1-oxopropan-2-yl] carbamate (PubChem CID 175387528) has the molecular formula C14H13F7N2O4 and a molecular weight of 406.25 g/mol. Its IUPAC name is [1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxyanilino]-1-oxopropan-2-yl] carbamate.
| Compound Name | [1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxyanilino]-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175387528 |
| Molecular Formula | C14H13F7N2O4 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxyanilino]-1-oxopropan-2-yl] carbamate |
| SMILES | COc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)C(C)OC(N)=O |
| InChI | InChI=1S/C14H13F7N2O4/c1-6(27-11(22)25)10(24)23-8-4-3-7(5-9(8)26-2)12(15,13(16,17)18)14(19,20)21/h3-6H,1-2H3,(H2,22,25)(H,23,24) |
| InChIKey | YCZKJQPAGTYNAM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |