C13H16F3NO4 — CID 38900928
(2R)-N-(2,4-dimethoxyphenyl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 38900928) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is (2R)-N-(2,4-dimethoxyphenyl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2R)-N-(2,4-dimethoxyphenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 38900928 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2R)-N-(2,4-dimethoxyphenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C13H16F3NO4/c1-8(21-7-13(14,15)16)12(18)17-10-5-4-9(19-2)6-11(10)20-3/h4-6,8H,7H2,1-3H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | BFNPWBOQWUMVKA-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |