C21H21N3O4 — CID 175387948
3-[4-(2-hydroxy-4-methylphenyl)phthalazin-1-yl]oxypiperidine-1-carboxylic acid (PubChem CID 175387948) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[4-(2-hydroxy-4-methylphenyl)phthalazin-1-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 3-[4-(2-hydroxy-4-methylphenyl)phthalazin-1-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175387948 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-[4-(2-hydroxy-4-methylphenyl)phthalazin-1-yl]oxypiperidine-1-carboxylic acid |
| SMILES | Cc1ccc(-c2nnc(OC3CCCN(C(=O)O)C3)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-13-8-9-17(18(25)11-13)19-15-6-2-3-7-16(15)20(23-22-19)28-14-5-4-10-24(12-14)21(26)27/h2-3,6-9,11,14,25H,4-5,10,12H2,1H3,(H,26,27) |
| InChIKey | KGTGKQRTVRMTJV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |