C22H25N3O — CID 170226442
5-methyl-2-[4-(1-piperidin-3-ylethyl)phthalazin-1-yl]phenol (PubChem CID 170226442) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 5-methyl-2-[4-(1-piperidin-3-ylethyl)phthalazin-1-yl]phenol.
| Compound Name | 5-methyl-2-[4-(1-piperidin-3-ylethyl)phthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 170226442 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 5-methyl-2-[4-(1-piperidin-3-ylethyl)phthalazin-1-yl]phenol |
| SMILES | Cc1ccc(-c2nnc(C(C)C3CCCNC3)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C22H25N3O/c1-14-9-10-19(20(26)12-14)22-18-8-4-3-7-17(18)21(24-25-22)15(2)16-6-5-11-23-13-16/h3-4,7-10,12,15-16,23,26H,5-6,11,13H2,1-2H3 |
| InChIKey | KZBROCQDEXWHEQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |