C22H24F3N5O3 — CID 175389720
1,1-difluoro-1-[2-fluoro-3-[1-[[2-methyl-7-(methylamino)-6-nitroquinazolin-4-yl]amino]ethyl]phenyl]-2-methylpropan-2-ol (PubChem CID 175389720) has the molecular formula C22H24F3N5O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is 1,1-difluoro-1-[2-fluoro-3-[1-[[2-methyl-7-(methylamino)-6-nitroquinazolin-4-yl]amino]ethyl]phenyl]-2-methylpropan-2-ol.
| Compound Name | 1,1-difluoro-1-[2-fluoro-3-[1-[[2-methyl-7-(methylamino)-6-nitroquinazolin-4-yl]amino]ethyl]phenyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 175389720 |
| Molecular Formula | C22H24F3N5O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1,1-difluoro-1-[2-fluoro-3-[1-[[2-methyl-7-(methylamino)-6-nitroquinazolin-4-yl]amino]ethyl]phenyl]-2-methylpropan-2-ol |
| SMILES | CNc1cc2nc(C)nc(NC(C)c3cccc(C(F)(F)C(C)(C)O)c3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24F3N5O3/c1-11(13-7-6-8-15(19(13)23)22(24,25)21(3,4)31)27-20-14-9-18(30(32)33)17(26-5)10-16(14)28-12(2)29-20/h6-11,26,31H,1-5H3,(H,27,28,29) |
| InChIKey | DWSPRRVYZMJCOM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|