C23H23F3IN5O2 — CID 156548306
8-[[[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]-iodomethyl]amino]-1,3,6-trimethylimidazo[4,5-g]quinazolin-2-one (PubChem CID 156548306) has the molecular formula C23H23F3IN5O2 and a molecular weight of 585.37 g/mol. Its IUPAC name is 8-[[[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]-iodomethyl]amino]-1,3,6-trimethylimidazo[4,5-g]quinazolin-2-one.
| Compound Name | 8-[[[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]-iodomethyl]amino]-1,3,6-trimethylimidazo[4,5-g]quinazolin-2-one |
|---|---|
| PubChem CID | 156548306 |
| Molecular Formula | C23H23F3IN5O2 |
| Molecular Weight | 585.37 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | 8-[[[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]-iodomethyl]amino]-1,3,6-trimethylimidazo[4,5-g]quinazolin-2-one |
| SMILES | Cc1nc(NC(I)c2cccc(C(F)(F)C(C)(C)O)c2F)c2cc3c(cc2n1)n(C)c(=O)n3C |
| InChI | InChI=1S/C23H23F3IN5O2/c1-11-28-15-10-17-16(31(4)21(33)32(17)5)9-13(15)20(29-11)30-19(27)12-7-6-8-14(18(12)24)23(25,26)22(2,3)34/h6-10,19,34H,1-5H3,(H,28,29,30) |
| InChIKey | YDSJYNHJBWAYIQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|