C10H18BN3O3 — CID 175390932
CID 175390932 (PubChem CID 175390932) has the molecular formula C10H18BN3O3 and a molecular weight of 239.08 g/mol.
| Compound Name | CID 175390932 |
|---|---|
| PubChem CID | 175390932 |
| Molecular Formula | C10H18BN3O3 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | — |
| SMILES | [B]CC[C@H]1CN(C(=O)[C@H](C)N)C[C@@]1(N)C(=O)O |
| InChI | InChI=1S/C10H18BN3O3/c1-6(12)8(15)14-4-7(2-3-11)10(13,5-14)9(16)17/h6-7H,2-5,12-13H2,1H3,(H,16,17)/t6-,7-,10-/m0/s1 |
| InChIKey | NVDFAYMWBLEGIQ-BYULHYEWSA-N |
| XLogP | -1.45 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|