C20H20FNO3 — CID 175391092
1-[(2S)-2-[2-(2-fluoro-3-methoxyphenoxy)phenyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 175391092) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 1-[(2S)-2-[2-(2-fluoro-3-methoxyphenoxy)phenyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S)-2-[2-(2-fluoro-3-methoxyphenoxy)phenyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175391092 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[(2S)-2-[2-(2-fluoro-3-methoxyphenoxy)phenyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H]1c1ccccc1Oc1cccc(OC)c1F |
| InChI | InChI=1S/C20H20FNO3/c1-3-19(23)22-13-7-9-15(22)14-8-4-5-10-16(14)25-18-12-6-11-17(24-2)20(18)21/h3-6,8,10-12,15H,1,7,9,13H2,2H3/t15-/m0/s1 |
| InChIKey | NZHJNYCSAHFKHJ-HNNXBMFYSA-N |
| XLogP | 4.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|