C24H27FN2O5 — CID 175393416
N-cyclohexyl-2-[4-[2-(4-fluoro-2-methylanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide (PubChem CID 175393416) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[2-(4-fluoro-2-methylanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide.
| Compound Name | N-cyclohexyl-2-[4-[2-(4-fluoro-2-methylanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175393416 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-cyclohexyl-2-[4-[2-(4-fluoro-2-methylanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide |
| SMILES | COc1cc(C(=O)C(=O)NC2CCCCC2)ccc1OCC(=O)Nc1ccc(F)cc1C |
| InChI | InChI=1S/C24H27FN2O5/c1-15-12-17(25)9-10-19(15)27-22(28)14-32-20-11-8-16(13-21(20)31-2)23(29)24(30)26-18-6-4-3-5-7-18/h8-13,18H,3-7,14H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | VCGDUAZSVQHPNO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|