C23H24F2N2O5 — CID 175393389
N-cyclohexyl-2-[4-[2-(2,4-difluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide (PubChem CID 175393389) has the molecular formula C23H24F2N2O5 and a molecular weight of 446.45 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[2-(2,4-difluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide.
| Compound Name | N-cyclohexyl-2-[4-[2-(2,4-difluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175393389 |
| Molecular Formula | C23H24F2N2O5 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-cyclohexyl-2-[4-[2-(2,4-difluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-oxoacetamide |
| SMILES | COc1cc(C(=O)C(=O)NC2CCCCC2)ccc1OCC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H24F2N2O5/c1-31-20-11-14(22(29)23(30)26-16-5-3-2-4-6-16)7-10-19(20)32-13-21(28)27-18-9-8-15(24)12-17(18)25/h7-12,16H,2-6,13H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | BWXYUAVEYMCMMJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|