About amino methanesulfonate;2-octyldodecyl acetate
amino methanesulfonate;2-octyldodecyl acetate (PubChem CID 175393788) has the molecular formula C23H49NO5S
and a molecular weight of 451.71 g/mol. Its IUPAC name is amino methanesulfonate;2-octyldodecyl acetate.
Molecular Properties
| Compound Name | amino methanesulfonate;2-octyldodecyl acetate |
| PubChem CID | 175393788 |
| Molecular Formula | C23H49NO5S |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | amino methanesulfonate;2-octyldodecyl acetate |
| SMILES | CCCCCCCCCCC(CCCCCCCC)COC(C)=O.CS(=O)(=O)ON |
| InChI | InChI=1S/C22H44O2.CH5NO3S/c1-4-6-8-10-12-13-15-17-19-22(20-24-21(3)23)18-16-14-11-9-7-5-2;1-6(3,4)5-2/h22H,4-20H2,1-3H3;2H2,1H3 |
| InChIKey | BKMZMQIXUGNLTF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino methanesulfonate;2-octyldodecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino methanesulfonate;2-octyldodecyl acetate?
The IUPAC name of amino methanesulfonate;2-octyldodecyl acetate (CID 175393788) is amino methanesulfonate;2-octyldodecyl acetate.
What is the SMILES notation for amino methanesulfonate;2-octyldodecyl acetate?
The canonical SMILES for amino methanesulfonate;2-octyldodecyl acetate is CCCCCCCCCCC(CCCCCCCC)COC(C)=O.CS(=O)(=O)ON.
What is the InChIKey of amino methanesulfonate;2-octyldodecyl acetate?
The InChIKey is BKMZMQIXUGNLTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.CH5NO3S/c1-4-6-8-10-12-13-15-17-19-22(20-24-21(3)23)18-16-14-11-9-7-5-2;1-6(3,4)5-2/h22H,4-20H2,1-3H3;2H2,1H3.
What are the key properties of amino methanesulfonate;2-octyldodecyl acetate?
amino methanesulfonate;2-octyldodecyl acetate has a molecular weight of 451.71 g/mol, XLogP of 6.28, 19 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino methanesulfonate;2-octyldodecyl acetate is sourced from PubChem (CID 175393788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).