C30H28FNO5S2 — CID 175394247
N-(benzenesulfonyl)-N-[3-fluoro-3-methyl-2-(4-phenylbenzoyl)butyl]benzenesulfonamide (PubChem CID 175394247) has the molecular formula C30H28FNO5S2 and a molecular weight of 565.69 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-[3-fluoro-3-methyl-2-(4-phenylbenzoyl)butyl]benzenesulfonamide.
| Compound Name | N-(benzenesulfonyl)-N-[3-fluoro-3-methyl-2-(4-phenylbenzoyl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175394247 |
| Molecular Formula | C30H28FNO5S2 |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | N-(benzenesulfonyl)-N-[3-fluoro-3-methyl-2-(4-phenylbenzoyl)butyl]benzenesulfonamide |
| SMILES | CC(C)(F)C(CN(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28FNO5S2/c1-30(2,31)28(29(33)25-20-18-24(19-21-25)23-12-6-3-7-13-23)22-32(38(34,35)26-14-8-4-9-15-26)39(36,37)27-16-10-5-11-17-27/h3-21,28H,22H2,1-2H3 |
| InChIKey | HONXVNLHQZPRIO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |